FLIAECGS0003
From Metabolomics.JP
(Redirected from CAS:94396-09-5)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAEC 6-Hydroxyorobol and O-methyl derivatives (21 pages) : FLIAECGS O-Glycoside (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 94396-09-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAECGS0003.mol |
| Iristectorigenin B 7-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (4-Hydroxy-3-methoxyphenyl) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C23H24O12 |
| Exact Mass | 492.126776232 |
| Average Mass | 492.42946 |
| SMILES | COc(c3O[C@@H]([C@@H](O)4)OC(CO)[C@@H]([C@@H]4O)O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
