FL2F1CNP0002
From Metabolomics.JP
(Redirected from CAS:78316-30-0)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F1C Butin and O-methyl derivatives (11 pages) : FL2F1CNP Pyranoflavonoid (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 78316-30-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1CNP0002.mol |
| 4'-Hydroxyisolonchocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4'-Hydroxy-6",6"-dimethylpyrano [ 2",3":7,8 ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H18O4 |
| Exact Mass | 322.120509064 |
| Average Mass | 322.35452 |
| SMILES | Oc(c1)ccc(C(C4)Oc(c3C(=O)4)c(c(cc3)2)C=CC(C)(C)O2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
