FL2F19NI0003
From Metabolomics.JP
(Redirected from CAS:78045-73-5)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F19 7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (14 pages) : FL2F19NI Non-cyclic prenyl substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 78045-73-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F19NI0003.mol |
| Ovaliflavanone B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-8-C-prenylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O3 |
| Exact Mass | 308.141244506 |
| Average Mass | 308.371 |
| SMILES | C(c(c3O)c(c(cc3)2)OC(CC2=O)c(c1)cccc1)C=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
