FL3F1ANI0005
From Metabolomics.JP
(Redirected from CAS:76690-67-0)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F1A 7,4'-Dihydroxyflavone and O-methyl derivatives (14 pages) : FL3F1ANI Non-cyclic prenyl substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76690-67-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F1ANI0005.mol |
| 7,4'-Dihydroxy-8-prenylflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-2- (4-hydroxyphenyl) -8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O4 |
| Exact Mass | 322.120509064 |
| Average Mass | 322.35452 |
| SMILES | Oc(c1)ccc(C(=C2)Oc(c(CC=C(C)C)3)c(ccc3O)C(=O)2)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
