FLIB1LNF0001
From Metabolomics.JP
(Redirected from CAS:76165-16-7)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIB Isoflavanone : FLIB1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavanone and O-methyl derivatives (20 pages) : FLIB1LNF Furanoflavonoid (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76165-16-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIB1LNF0001.mol |
| Neoraunone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Neoraunone |
| Common Name |
|
| Symbol | |
| Formula | C19H16O5 |
| Exact Mass | 324.099773622 |
| Average Mass | 324.32734 |
| SMILES | c(c(C(C4=O)COc(c43)cc(c2c3)occ2)1)(OC)cc(OC)cc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
