FL5F29GF0001
From Metabolomics.JP
(Redirected from CAS:713524-65-3)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5F29 6,7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (1 pages) : FL5F29GF Furanoflavonoid O-glycoside (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 713524-65-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F29GF0001.mol |
| Pongamoside C | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6- (beta-D-Glucopyranosyloxy) -3-methoxy-2-phenyl-4H-furo [ 2,3-h ] -1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C24H22O10 |
| Exact Mass | 470.121296924 |
| Average Mass | 470.42548 |
| SMILES | c(o5)(c(cc5)1)c(OC(C4O)OC(CO)C(O)C4O)cc(C(=O)3)c1O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
