FL1DHYNS0004
From Metabolomics.JP
(Redirected from CAS:70185-51-2)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DHY beta-Hydroxydihydroflavonol (9 pages) : FL1DHYNS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70185-51-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DHYNS0004.mol |
| beta-Hydroxy-2',6'-dimethoxy-3',4'-methylenedioxydihydrochalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | beta-Hydroxy-2',6'-dimethoxy-3',4'-methylenedioxydihydrochalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H18O6 |
| Exact Mass | 330.110338308 |
| Average Mass | 330.33191999999997 |
| SMILES | C(c(c(OC)3)c(c(c2c3)OCO2)OC)(=O)CC(O)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
