FLIA1ANP0002
From Metabolomics.JP
(Redirected from CAS:63807-86-3)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA1A Daidzein and O-methyl derivatives (35 pages) : FLIA1ANP Pyranoflavonoid (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63807-86-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA1ANP0002.mol |
| Erythrinin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- (4-Hydroxyphenyl) -2,2-dimethyl-2H,6H-benzo [ 1,2-b:5,4-b' ] dipyran-6-one |
| Common Name |
|
| Symbol | |
| Formula | C20H16O4 |
| Exact Mass | 320.104859 |
| Average Mass | 320.33864 |
| SMILES | Oc(c1)ccc(C(C(=O)4)=COc(c43)cc(c2c3)OC(C=C2)(C)C)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
