FL1ABCNS0001
From Metabolomics.JP
(Redirected from CAS:54826-89-0)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1ABC Rengasin (2 pages) : FL1ABCNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 54826-89-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1ABCNS0001.mol |
| Rengasin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ (Z) - (3,4-Dihydroxyphenyl) methylene ] -6-hydroxy-4-methoxy-3 (2H) -benzofuranone |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | COc(c3)c(c(=O)1)c(cc(O)3)oc(=Cc(c2)cc(O)c(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
