FL3F4AGS0001
From Metabolomics.JP
(Redirected from CAS:491613-67-3)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F4A 6,7,8,4'-Tetrahydroxyflavone and O-methyl derivatives (0 pages) : FL3F4AGS O-Glycoside (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 491613-67-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F4AGS0001.mol |
| 6,8-Dihydroxy-7,4'-dimethoxyflavone 6-rutinoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6- [ [ 6-O- (6-deoxy-alpha-L-mannopyranosyl) -beta-D-glucopyranosyl ] oxy ] -8-hydroxy-7-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C29H34O15 |
| Exact Mass | 622.189770418 |
| Average Mass | 622.5712599999999 |
| SMILES | c(c5OC)(cc(c(c(O)5)4)C(=O)C=C(O4)c(c3)ccc(OC)c3)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
