FL1CQUNM0005
From Metabolomics.JP
(Redirected from CAS:371194-02-4)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CQU Quinochalcone (14 pages) : FL1CQUNM C-Methyl or C2/C3 substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 371194-02-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CQUNM0005.mol |
| Infectocaryone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ (1R) -5-Oxo-6- (1-hydroxy-3-phenyl-2-propenylidene) -3-cyclohexenyl ] acetic acid methyl ester |
| Common Name |
|
| Symbol | |
| Formula | C18H18O4 |
| Exact Mass | 298.120509064 |
| Average Mass | 298.33312 |
| SMILES | C(C1=C(O)C=Cc(c2)cccc2)(CC=CC1=O)CC(=O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
