FL5FAAGS0132
From Metabolomics.JP
(Redirected from CAS:352283-41-1)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAAGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (140 pages) : FL5FAAGS0 Normal (138 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 352283-41-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAAGS0132.mol |
| Kaempferol 3-glucosyl- (1->2) -rhamnoside-7- (6"- (E) -p-coumaroylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- [ (6-Deoxy-2-O-beta-D-glucopyranosyl-alpha-L-mannopyranosyl) oxy ] -5-hydroxy-2- (4-hydroxyphenyl) -7- [ [ 6-O- [ (2E) -3- (4-hydroxyphenyl) -1-oxo-2-propenyl ] -beta-D-glucopyranosyl ] oxy ] -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C42H46O22 |
| Exact Mass | 902.248073156 |
| Average Mass | 902.80144 |
| SMILES | O(C(C=Cc(c7)ccc(c7)O)=O)CC(O1)C(O)C(O)C(O)C1Oc(c6) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
