FL5FEAGS0026
From Metabolomics.JP
(Redirected from CAS:340970-65-2)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEAGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (25 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 340970-65-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEAGS0026.mol |
| 3-Hydroxy-5,4'-dimethoxy-6,7-methylenedioxyflavone 3-xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-Methoxy-6- (4-methoxyphenyl) -7- (beta-D-xylopyranosyloxy) -8H-1,3-dioxolo [ 4,5-g ] [ 1 ] benzopyran-8-one |
| Common Name |
|
| Symbol | |
| Formula | C23H22O11 |
| Exact Mass | 474.116211546 |
| Average Mass | 474.41418000000004 |
| SMILES | C(=O)(c23)C(=C(c(c5)ccc(OC)c5)Oc2cc(O4)c(OC4)c3OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
