FL3FEGGS0003
From Metabolomics.JP
(Redirected from CAS:221269-70-1)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEG 6-Hydroxytricetin and O-methyl derivatives (20 pages) : FL3FEGGS O-Glycoside (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 221269-70-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEGGS0003.mol |
| 6-Hydroxytricetin 6,3',5'-trimethyl eter 7-alpha-L-arabinosyl- (1->6) -glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- [ (6-O-alpha-L-Arabinopyranosyl-beta-D-glucopyranosyl) oxy ] -5-hydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C29H34O17 |
| Exact Mass | 654.179599662 |
| Average Mass | 654.57006 |
| SMILES | O(C)c(c3OC(O4)C(C(C(O)C4COC(O5)C(O)C(O)C(C5)O)O)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
