FL2FA9NN0002
From Metabolomics.JP
(Redirected from CAS:143291-31-0)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FA9 5,7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (90 pages) : FL2FA9NN Flavonophenylpropanoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 143291-31-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NN0002.mol |
| Calomelanol J | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4,7,8-Tetrahydro-5-hydroxy-4,8-diphenyl-2H,6H-benzo [ 1,2-b:5,4-b' ] dipyran-2,6-dione |
| Common Name |
|
| Symbol | |
| Formula | C24H18O5 |
| Exact Mass | 386.115423686 |
| Average Mass | 386.39672 |
| SMILES | c(c34)c(c(c(O)c3C(=O)CC(c(c5)cccc5)O4)1)OC(=O)CC1c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
