FLID4CNS0001
From Metabolomics.JP
(Redirected from CAS:131442-28-9)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID4C 2,3,4,8,9-Pentahydroxypterocarpane or 2,3,4,9,10-Pentahydroxypterocarpane and O-methyl derivatives (0 pages) : FLID4CNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 131442-28-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID4CNS0001.mol |
| 2-Hydroxy-4-methoxypterocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Hydroxy-3,4-dimethoxy-8,9-methylenedioxypterocarpan |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c45)c(O3)c(cc4OCO5)C(C31)COc(c2OC)c(cc(c2OC)O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
