FLIAELNS0002
From Metabolomics.JP
(Redirected from CAS:126595-77-5)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAEL 5,6,7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (3 pages) : FLIAELNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 126595-77-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAELNS0002.mol |
| Dalpalatin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-6,2'-dimethoxy-4',5'-methylenedioxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O8 |
| Exact Mass | 358.068867424 |
| Average Mass | 358.29896 |
| SMILES | c(c4OC)(O)cc(c(c4O)3)OC=C(C3=O)c(c2)c(OC)cc(c21)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
