FLIAALNP0012
From Metabolomics.JP
(Redirected from CAS:117204-81-6)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAL 5,7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (59 pages) : FLIAALNP Pyranoflavonoid (17 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 117204-81-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAALNP0012.mol |
| Allolicoisoflavone B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (2,2-Dimethyl-5-hydroxy-2H-1-benzopyran-8-yl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H16O6 |
| Exact Mass | 352.094688244 |
| Average Mass | 352.33744 |
| SMILES | c(c1)c(O)c(C=4)c(OC(C4)(C)C)c1C(C(=O)2)=COc(c3)c2c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
