FL3FECNSS008
From Metabolomics.JP
(Redirected from CAS:111509-46-7)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEC 6-Hydroxyluteolin and O-methyl derivatives (85 pages) : FL3FECNS Simple substitution (32 pages) : FL3FECNSS Sulfate incluted (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 111509-46-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNSS008.mol |
| 6-Hydroxyluteolin 6,3'-dimethyl ether 7-sulfate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-6,3'-dimethoxyflavone 7-sulfate |
| Common Name |
|
| Symbol | |
| Formula | C17H14O10S |
| Exact Mass | 410.030767358 |
| Average Mass | 410.35306 |
| SMILES | COc(c(O)3)cc(cc3)C(=C2)Oc(c1)c(C(=O)2)c(O)c(OC)c1O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
