LBF21307PG03
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1745 | |LipidBank=XPR1745 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR1745 |
| LipidMaps | LMFA03010063 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF21307PG03.mol |
| 15 (R) -15-methyl Prostaglandin E2 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-oxo-11alpha,15R-dihydroxy-15-methyl-prosta-5Z,13E-dien-1-oic acid |
| Common Name |
|
| Symbol | |
| Formula | C21H34O5 |
| Exact Mass | 366.240624198 |
| Average Mass | 366.49166 |
| SMILES | C(=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](CC1=O)O)[C@@] |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
