LBF20406HO06
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8089 |
LipidMaps | LMFA03060044 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO06.mol |
Structural Information | |
---|---|
Systematic Name | 8,15-Dihydroperoxy-5,9,11,13-Eicosatetraenoic Acid/8,15-Dihydroperoxy-5,9,11,13-Eicosatetraenoate |
Common Name | |
Symbol | |
Formula | C20H32O6 |
Exact Mass | 368.219888756 |
Average Mass | 368.46448 |
SMILES | C(CCC(OO)C=CC=CC=CC(OO)CC=CCCCC(O)=O)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | EI-MS(Me-ester; after reduction)<<8108>>: m/e=350[M]; 332[M-H2O]; 301[332-OCH3]; 261[332-(CH2)4CH3]; 209[M-CH=CH(CH2)4COOCH3]; 191[209-H2O]; GC-EI-MS(Me-ester; after reduction, hydrogenation and TMS)<<8097/8098>>: m/e=487[M-CH3]; 431[M-(CH2)4CH3]; 359[M-(CH2)6COOCH3] |
UV Spectra | UV(Me-ester)<<8098>> conjugated triene: 270nm and 281nm |
IR Spectra | IR(Me-estre)<<8098>>OOH group: 3400cm-1, IR(after reduction)<<8108>> trans unsaturation: 968cm-1, OH group: 1040, 3540cm-1 |
NMR Spectra | 1H-NMR(Me-ester)<<8098>> OOH: 8.3ppm, 1H-NMR(after reduction)<<8108>> C8, C15: 4.2ppm; OH: 6.3ppm |
Chromatograms |