LBF20406AM39
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | XPR7061 |
LipidMaps | LMFA08020047 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM39.mol |
Structural Information | |
---|---|
Systematic Name | N- ( (R) - (-) -2-hydroxypropyl) alpha,alpha-dimethylarachidonoylamide |
Common Name | |
Symbol | |
Formula | C25H43NO2 |
Exact Mass | 389.329379625 |
Average Mass | 389.61446 |
SMILES | CC(C)(C(=O)NC[C@@H](C)O)CCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d 5.95 (br s, l H), 5.30-5.42 (m, 8H), 3.92-3.96 (m, 1H), 3.40-3.50 (m, 1H), 3.02-3.23 (m, 1H), 2.70-2.95 (m, 7H), 2.20-2.28(m, 1H), 2.00-2.15 (m, 4H), 1.70-1.75 (m, 2H), 1.20-1.52 (series of m, 14H), 0.89 (t, J=6.7 Hz, 3H), <<7001>> |
Chromatograms |