LBF20406AM24
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7040 | |LipidBank=XPR7040 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7040 |
| LipidMaps | LMFA08020026 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM24.mol |
| |
| Structural Information | |
| Systematic Name | N-ethyl -N- (2-hydroxyethyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO2 |
| Exact Mass | 375.313729561 |
| Average Mass | 375.58788 |
| SMILES | N(C(=O)CCCC=CCC=CCC=CCC=CCCCCC)(CCO)CC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.31-5.42 (m, 8H), 3.75 (t, J=4.6 Hz, 2H), 3.51 (t, J=4.6Hz, 2H), 3.34(q, J=7.l Hz, 2H), 3.34 (q, J=7.l Hz, 2H), 2.79-2.86 (m, 6H), 2.35 (t, J=7.8Hz, 2H), 2.04-2.15(m, 4H), 1.64-1.77 (m, 2H), 1.25-1.40 (m, 6H), 1.19 (t, J=7.l Hz, 3H), 0.89 (t, J=7.lHz, 3H).<<7001>> |
| Chromatograms | |
