LBF20207PG13
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1736 | |LipidBank=XPR1736 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR1736 |
| LipidMaps | LMFA03010054 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20207PG13.mol |
| 11-deoxy Prostaglandin E1 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-oxo-15S-hydroxy-prosto-13E-en-1-oic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H34O4 |
| Exact Mass | 338.24570957599997 |
| Average Mass | 338.48156 |
| SMILES | C(CC[C@@H](O)C=C[C@H]([C@H]1CCCCCCC(O)=O)CCC(=O)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
