LBF18306SC03
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0182 |
| LipidMaps | LMFA01030143 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18306SC03.mol |
| |
| Structural Information | |
| Systematic Name | cis-8, trans-10, cis-12-Octadecatrienoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CC=CC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 43.5-44°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | very soluble in petroleumether and soluble in acetone, ethanol, CS2 and pentane.<<0125>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
