LBF18306SC02
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0180 |
| LipidMaps | LMFA01030141 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18306SC02.mol |
| gamma-Linolenic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-6, cis-9, cis-12-Octadecatrienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | -11.3 to -11°C |
| Boiling Point | 125°C at 0.05mmHg |
| Density | dX420 0.9164 |
| Optical Rotation | 1.4800 at 20°C |
| Reflactive Index | |
| Solubility | soluble in acetone, ether, methylalcohol and petroleum ether.<<0352>><<0383>><<0415>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
