LBF18107HO04
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA8031 |
| LipidMaps | LMFA01050133 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18107HO04.mol |
| |
| Structural Information | |
| Systematic Name | 9,10,13-Trihydroxy-11-Octadecenoic Acid/9,10,13-Trihydroxy-11-Octadecenoate |
| Common Name | |
| Symbol | |
| Formula | C18H34O5 |
| Exact Mass | 330.240624198 |
| Average Mass | 330.45956 |
| SMILES | CCCCCC(O)C=CC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8059/8017/8056/8069/8009/8066/8012>>: m/e=545[M-CH3], 529[M-OCH3], 259[SMTO=CH-(CH2)7COOCH3], 173[SMTO=CH-(CH2)4CH3], 387[M-173], 298[387-HOTMS]GC-EI-MS(after methanolysis, trimethylsilylation and isopropyliden derivative treatment)<<8056>>, GC-EIMS(after methanolysis, hydrogenation and trimethylsilylation)<<8009/8092>>: m/e=562[M], 547[M-CH3] |
| UV Spectra | |
| IR Spectra | Methyl ester: olefinic trans unsaturation(990-965cm-1), free OH(3620-3595 cm-1), bonded OH(3640-3160cm-1) <<8059/8017/8056/8069/8009/8071/8066>> |
| NMR Spectra | 1H-NMR(methyl ester)<<8017/8009>>: olefinic protons(5.76ppm), C10, 13(3.7-4.2ppm) C9(3.2-3.6ppm), OH(3.6ppm) |
| Chromatograms | |
