LBF16402SC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0203 |
| LipidMaps | LMFA01030164 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16402SC01.mol |
| |
| Structural Information | |
| Systematic Name | 4, 7, 11, 14-Hexadesatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C16H24O2 |
| Exact Mass | 248.17763001199998 |
| Average Mass | 248.36056 |
| SMILES | CC=CCC=CCC=CCCC=CCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone, alcohol, ether, carbon disuifide and petroleum ether.<<0510>><<0511>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
