LBF16000OX07
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0440 | |LipidBank=DFA0440 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0440 |
LipidMaps | LMFA01060056 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16000OX07.mol |
9-Ketopalmitic acid | |
---|---|
Structural Information | |
Systematic Name | 9-Oxohexadecanoic acid |
Common Name |
|
Symbol | |
Formula | C16H30O3 |
Exact Mass | 270.21949482599996 |
Average Mass | 270.4076 |
SMILES | CCCCCCCC(=O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 73.5-74.5°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0154>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |