FLIBALNS0006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,4'-Trihydroxy-2',3'-dimethoxyisoflavanone | |SysName=5,7,4'-Trihydroxy-2',3'-dimethoxyisoflavanone | ||
| − | |Common Name=&&Parvisoflavanone&& | + | |Common Name=&&Parvisoflavanone&&5,7,4'-Trihydroxy-2',3'-dimethoxyisoflavanone&& |
|CAS=49776-79-6 | |CAS=49776-79-6 | ||
|KNApSAcK=C00009555 | |KNApSAcK=C00009555 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 49776-79-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIBALNS0006.mol |
| Parvisoflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-2',3'-dimethoxyisoflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O7 |
| Exact Mass | 332.089602866 |
| Average Mass | 332.30474 |
| SMILES | COc(c(O)3)c(OC)c(cc3)C(C1)C(=O)c(c(O)2)c(cc(O)c2)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
