FL6FAAGS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,4'-Trihydroxyflavan 5-O-xyloside | |SysName=5,7,4'-Trihydroxyflavan 5-O-xyloside | ||
| − | |Common Name=&&Apigeniflavan 5-O-xyloside&& | + | |Common Name=&&Apigeniflavan 5-O-xyloside&&5,7,4'-Trihydroxyflavan 5-O-xyloside&& |
|CAS=61402-86-6 | |CAS=61402-86-6 | ||
|KNApSAcK=C00008771 | |KNApSAcK=C00008771 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61402-86-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FAAGS0001.mol |
| Apigeniflavan 5-O-xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavan 5-O-xyloside |
| Common Name |
|
| Symbol | |
| Formula | C20H22O8 |
| Exact Mass | 390.13146768 |
| Average Mass | 390.38388000000003 |
| SMILES | C(O1)(Oc(c4)c(c(cc(O)4)3)CCC(O3)c(c2)ccc(O)c2)C(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
