FL64A9NP0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=4,5-Dimethoxy-8,8-dimethyl-8H-pyrano[2,3-h]flavan | + | |SysName=4,5-Dimethoxy-8,8-dimethyl-8H-pyrano [ 2,3-h ] flavan |
− | |Common Name=&&Methylhildgardtol B&&4,5-Dimethoxy-8,8-dimethyl-8H-pyrano[2,3-h]flavan&& | + | |Common Name=&&Methylhildgardtol B&&4,5-Dimethoxy-8,8-dimethyl-8H-pyrano [ 2,3-h ] flavan&& |
|CAS=104777-99-3 | |CAS=104777-99-3 | ||
|KNApSAcK=C00008987 | |KNApSAcK=C00008987 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 104777-99-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL64A9NP0002.mol |
Methylhildgardtol B | |
---|---|
Structural Information | |
Systematic Name | 4,5-Dimethoxy-8,8-dimethyl-8H-pyrano [ 2,3-h ] flavan |
Common Name |
|
Symbol | |
Formula | C22H24O4 |
Exact Mass | 352.167459256 |
Average Mass | 352.42356 |
SMILES | O(c31)C(c(c4)cccc4)CC(c1c(cc(c32)OC(C=C2)(C)C)OC)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|