FL64A9NF0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=8,9-Dihydro-4,5-dihydroxy-8-isopropenylfurano[2,3-h]flavan | + | |SysName=8,9-Dihydro-4,5-dihydroxy-8-isopropenylfurano [ 2,3-h ] flavan |
| − | |Common Name=&&Methylhildgardtol A&&8,9-Dihydro-4,5-dihydroxy-8-isopropenylfurano[2,3-h]flavan&& | + | |Common Name=&&Methylhildgardtol A&&8,9-Dihydro-4,5-dihydroxy-8-isopropenylfurano [ 2,3-h ] flavan&& |
|CAS=104777-97-1 | |CAS=104777-97-1 | ||
|KNApSAcK=C00008985 | |KNApSAcK=C00008985 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 104777-97-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL64A9NF0002.mol |
| Methylhildgardtol A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8,9-Dihydro-4,5-dihydroxy-8-isopropenylfurano [ 2,3-h ] flavan |
| Common Name |
|
| Symbol | |
| Formula | C22H24O4 |
| Exact Mass | 352.167459256 |
| Average Mass | 352.42356 |
| SMILES | C(C)(=C)C(C1)Oc(c2)c1c(O3)c(C(CC3c(c4)cccc4)OC)c2O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
