FL63AGNS0017
From Metabolomics.JP
(Difference between revisions)
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(2S)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,5,7-triol | |SysName=(2S)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,5,7-triol | ||
| − | |Common Name=&&(-)-Gallocatechin&&ent-Gallocatechin&&GC | + | |Common Name=&&(-)-Gallocatechin&&ent-Gallocatechin&&GC&& |
|CAS=3371-27-5 | |CAS=3371-27-5 | ||
|KNApSAcK=C00034981 | |KNApSAcK=C00034981 | ||
}} | }} | ||
Revision as of 11:54, 24 December 2009
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AG Gallocatechin and Epigallocatechin (23 pages) : FL63AGNS Simple substitution (17 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3371-27-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AGNS0017.mol |
| (-)-Gallocatechin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,5,7-triol |
| Common Name |
|
| Symbol | |
| Formula | C15H14O7 |
| Exact Mass | 306.073952802 |
| Average Mass | 306.26746 |
| SMILES | Oc(c1)cc(O2)c(CC(O)C2c(c3)cc(O)c(O)c(O)3)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
