FL5FGCNS0008
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
|Common Name=&&5,3',4'-Trihydroxy-3,6,7,8-tetramethoxyflavone&&5,4',5'-Trihydroxy-3,6,7,8-tetramethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&5,3',4'-Trihydroxy-3,6,7,8-tetramethoxyflavone&&5,4',5'-Trihydroxy-3,6,7,8-tetramethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=81943-52-4 | |CAS=81943-52-4 | ||
|KNApSAcK=C00004793 | |KNApSAcK=C00004793 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 81943-52-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FGCNS0008.mol |
5,3',4'-Trihydroxy-3,6,7,8-tetramethoxyflavone | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C19H18O9 |
Exact Mass | 390.095082174 |
Average Mass | 390.34082 |
SMILES | c(C(O2)=C(C(c(c3O)c2c(c(c3OC)OC)OC)=O)OC)(c1)cc(O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |