FL5FFANS0014
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Herbacetin 3,8,4'-trimethyl ether | + | |SysName=Herbacetin 3,8,4'-trimethyl ether |
|Common Name=&&Herbacetin 3,8,4'-trimethyl ether&&5,7-Dihydroxy-3,8,4'-trimethoxyflavone&&3,8,4'-Trimethylherbacetin&&5,7-dDihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Herbacetin 3,8,4'-trimethyl ether&&5,7-Dihydroxy-3,8,4'-trimethoxyflavone&&3,8,4'-Trimethylherbacetin&&5,7-dDihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=1570-09-8 | |CAS=1570-09-8 | ||
|KNApSAcK=C00004621 | |KNApSAcK=C00004621 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1570-09-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FFANS0014.mol |
Herbacetin 3,8,4'-trimethyl ether | |
---|---|
Structural Information | |
Systematic Name | Herbacetin 3,8,4'-trimethyl ether |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(c1OC)(O)cc(c(C2=O)c(OC(c(c3)ccc(OC)c3)=C2OC)1)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |