FL5FFAGS0016
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,8,4'-Pentahydroxyflavone 8,4'-dixyloside | |SysName=3,5,7,8,4'-Pentahydroxyflavone 8,4'-dixyloside | ||
| − | |Common Name=&&Herbacetin 8,4'-dixyloside&& | + | |Common Name=&&Herbacetin 8,4'-dixyloside&&3,5,7,8,4'-Pentahydroxyflavone 8,4'-dixyloside&& |
|CAS=90193-30-9 | |CAS=90193-30-9 | ||
|KNApSAcK=C00005352 | |KNApSAcK=C00005352 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 90193-30-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFAGS0016.mol |
| Herbacetin 8,4'-dixyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,8,4'-Pentahydroxyflavone 8,4'-dixyloside |
| Common Name |
|
| Symbol | |
| Formula | C25H26O15 |
| Exact Mass | 566.127170162 |
| Average Mass | 566.46494 |
| SMILES | c(OC(C5O)OCC(O)C5O)(c4)ccc(c4)C(=C3O)Oc(c(C3=O)2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
