FL5FAHGL0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3-(beta-D-Glucopyranosyloxy)-3'-methoxy-4',5,5',7-tetrahydroxyflavone | |SysName=3-(beta-D-Glucopyranosyloxy)-3'-methoxy-4',5,5',7-tetrahydroxyflavone | ||
− | |Common Name=&&Laricitrin 3-glucoside&& | + | |Common Name=&&Laricitrin 3-glucoside&&3-(beta-D-Glucopyranosyloxy)-3'-methoxy-4',5,5',7-tetrahydroxyflavone&& |
|CAS=39986-90-8 | |CAS=39986-90-8 | ||
|KNApSAcK=C00005761 | |KNApSAcK=C00005761 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 39986-90-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FAHGL0001.mol |
Laricitrin 3-glucoside | |
---|---|
Structural Information | |
Systematic Name | 3-(beta-D-Glucopyranosyloxy)-3'-methoxy-4',5,5',7-tetrahydroxyflavone |
Common Name |
|
Symbol | |
Formula | C22H22O13 |
Exact Mass | 494.10604078999995 |
Average Mass | 494.40228 |
SMILES | c(C(=O)1)(c4O)c(cc(c4)O)OC(c(c3)cc(OC)c(O)c(O)3)=C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |