FL5FACGS0006
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 522-12-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FACGS0006.mol |
Quercitrin | |
---|---|
Structural Information | |
Systematic Name | Quercitrin&&Quercetin 3-O-rhamnopyranoside |
Common Name |
|
Symbol | |
Formula | C21H20O11 |
Exact Mass | 448.100561482 |
Average Mass | 448.3769 |
SMILES | C(C(=O)3)(=C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |