FL5F39NS0001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 94393-12-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5F39NS0001.mol |
Zuccagin | |
---|---|
Structural Information | |
Systematic Name | Zuccagin |
Common Name |
|
Symbol | |
Formula | C16H12O5 |
Exact Mass | 284.068473494 |
Average Mass | 284.26348 |
SMILES | COc(c(O)3)c(O1)c(cc3)C(=O)C(O)=C(c(c2)cccc2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|