FL3FFANS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=5,7,4'-Trihydroxy-8-methoxyflavone |
|Common Name=&&Isoscutellarein 8-methyl ether&&5,7,4'-Trihydroxy-8-methoxyflavone&&4'-Hydroxywogonin&&8-Methoxyapigenin&& | |Common Name=&&Isoscutellarein 8-methyl ether&&5,7,4'-Trihydroxy-8-methoxyflavone&&4'-Hydroxywogonin&&8-Methoxyapigenin&& | ||
|CAS=57096-02-3 | |CAS=57096-02-3 | ||
|KNApSAcK=C00003850 | |KNApSAcK=C00003850 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 57096-02-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FFANS0003.mol |
Isoscutellarein 8-methyl ether | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C16H12O6 |
Exact Mass | 300.063388116 |
Average Mass | 300.26288 |
SMILES | COc(c(O)3)c(O1)c(c(O)c3)C(=O)C=C(c(c2)ccc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |