FL3FECNS0024
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-Dimethoxyphenyl) -5,6,7-trimethoxy-4H-1-benzopyran-4-one |
− | |Common Name=&&5,6,7,3',4'-Pentamethoxyflavone&&Pedalitin permethyl ether&&Sinensetin&&2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,6,7,3',4'-Pentamethoxyflavone&&Pedalitin permethyl ether&&Sinensetin&&2- (3,4-Dimethoxyphenyl) -5,6,7-trimethoxy-4H-1-benzopyran-4-one&& |
|CAS=2306-27-6 | |CAS=2306-27-6 | ||
|KNApSAcK=C00013596 | |KNApSAcK=C00013596 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 2306-27-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FECNS0024.mol |
5,6,7,3',4'-Pentamethoxyflavone | |
---|---|
Structural Information | |
Systematic Name | 2- (3,4-Dimethoxyphenyl) -5,6,7-trimethoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C20H20O7 |
Exact Mass | 372.120902994 |
Average Mass | 372.3686 |
SMILES | c(C(=O)1)(c3OC)c(cc(c3OC)OC)OC(c(c2)cc(c(c2)OC)OC) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |