FL2F2CNP0002
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2S)-6,3',4'-Trimethoxy-6",6"-dimethylpyrano[2",3":7,8]flavanone | + | |SysName= (2S) -6,3',4'-Trimethoxy-6",6"-dimethylpyrano [ 2",3":7,8 ] flavanone |
| − | |Common Name=&&Ponganone IV&&(2S)-6,3',4'-Trimethoxy-6",6"-dimethylpyrano[2",3":7,8]flavanone&& | + | |Common Name=&&Ponganone IV&& (2S) -6,3',4'-Trimethoxy-6",6"-dimethylpyrano [ 2",3":7,8 ] flavanone&& |
|CAS=142608-90-0 | |CAS=142608-90-0 | ||
|KNApSAcK=C00014244 | |KNApSAcK=C00014244 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F2C Plathymenin and O-methyl derivatives (4 pages) : FL2F2CNP Pyranoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 142608-90-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F2CNP0002.mol |
| Ponganone IV | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -6,3',4'-Trimethoxy-6",6"-dimethylpyrano [ 2",3":7,8 ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C23H24O6 |
| Exact Mass | 396.1572885 |
| Average Mass | 396.43306 |
| SMILES | c(C(O2)CC(c(c4)c(c(c(c4OC)3)C=CC(O3)(C)C)2)=O)(c1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
