FL1CA9NI0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=2',4',6'-Trihydroxy-3'-prenylchalcone |
|Common Name=&&Desmethylisoxanthohumol&& | |Common Name=&&Desmethylisoxanthohumol&& | ||
|CAS=72247-78-0 | |CAS=72247-78-0 | ||
|KNApSAcK=C00007078 | |KNApSAcK=C00007078 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 72247-78-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CA9NI0001.mol |
Desmethylisoxanthohumol | |
---|---|
Structural Information | |
Systematic Name | 2',4',6'-Trihydroxy-3'-prenylchalcone |
Common Name |
|
Symbol | |
Formula | C20H20O4 |
Exact Mass | 324.136159128 |
Average Mass | 324.37039999999996 |
SMILES | C(c(c1O)c(cc(c1C(=O)C=Cc(c2)cccc2)O)O)C=C(C)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |