FL1C3CGS0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=4'-(4-O-alpha-L-Arabinofuranosyl-beta-D-glucopyranosyloxy)-2',3,3',4-tetrahydroxychalcone | |SysName=4'-(4-O-alpha-L-Arabinofuranosyl-beta-D-glucopyranosyloxy)-2',3,3',4-tetrahydroxychalcone | ||
| − | |Common Name=&&Okanin 4'-alpha-L-arabinofuranosyl-(1->4)-glucoside&& | + | |Common Name=&&Okanin 4'-alpha-L-arabinofuranosyl-(1->4)-glucoside&&4'-(4-O-alpha-L-Arabinofuranosyl-beta-D-glucopyranosyloxy)-2',3,3',4-tetrahydroxychalcone&& |
|CAS=77587-43-0 | |CAS=77587-43-0 | ||
|KNApSAcK=C00007902 | |KNApSAcK=C00007902 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77587-43-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C3CGS0011.mol |
| Okanin 4'-alpha-L-arabinofuranosyl-(1->4)-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4'-(4-O-alpha-L-Arabinofuranosyl-beta-D-glucopyranosyloxy)-2',3,3',4-tetrahydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C26H30O15 |
| Exact Mass | 582.15847029 |
| Average Mass | 582.5074 |
| SMILES | c(O)(c2OC(C(O)4)OC(C(C(O)4)OC(O3)C(C(C3CO)O)O)CO)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
