FL1C1ANP0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=(E)-1-(2,4-Dihydroxyphenyl)-3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-2-propen-1-one |
|Common Name=&&Kanzonol B&& | |Common Name=&&Kanzonol B&& | ||
|CAS=155233-19-5 | |CAS=155233-19-5 | ||
|KNApSAcK=C00007059 | |KNApSAcK=C00007059 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 155233-19-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1C1ANP0001.mol |
Kanzonol B | |
---|---|
Structural Information | |
Systematic Name | (E)-1-(2,4-Dihydroxyphenyl)-3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-2-propen-1-one |
Common Name |
|
Symbol | |
Formula | C20H18O4 |
Exact Mass | 322.120509064 |
Average Mass | 322.35452 |
SMILES | c(c32)cc(cc(C=CC(O3)(C)C)2)C=CC(=O)c(c(O)1)ccc(O)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|