BMMCPYURq003
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C04732 |
KNApSAcK | |
CDX file | |
MOL file | BMMCPYURq003.mol |
4- (1-D-Ribitylamino) -5-amino-2,6-dihydroxypyrimidine | |
---|---|
Structural Information | |
Systematic Name | 4- (1-D-Ribityl-amino) -5-amino-2,6-dihydroxy-pyrimidine |
Common Name |
|
Symbol | |
Formula | C9H16N4O6 |
Exact Mass | 276.1069 |
Average Mass | 276.2467 |
SMILES | OC[C@H](O)[C@H](O)[C@H](O)CNC(N1)=C(N)C(=O)NC(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways