BMMCLA--q013
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1128-23-0 |
KEGG | C01040 |
KNApSAcK | |
CDX file | |
MOL file | BMMCLA--q013.mol |
L-Gulono-1,4-lactone | |
---|---|
Structural Information | |
Systematic Name | L-Gulono-1,4-lactone |
Common Name |
|
Symbol | |
Formula | C6H10O6 |
Exact Mass | 178.0477 |
Average Mass | 178.1399 |
SMILES | OC[C@H](O)[C@@H](O1)[C@H](O)[C@H](O)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways