BMMCIZ--l001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)(-)-Allantoin | + | |SysName= (R) (-) -Allantoin |
| − | |Common Name=&&(R)(-)-Allantoin&&(R)-Allantoin&& | + | |Common Name=&& (R) (-) -Allantoin&& (R) -Allantoin&& |
|CAS=7303-80-2 | |CAS=7303-80-2 | ||
|KEGG=C02348 | |KEGG=C02348 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 7303-80-2 |
| KEGG | C02348 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCIZ--l001.mol |
| (R) (-) -Allantoin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) (-) -Allantoin |
| Common Name |
|
| Symbol | |
| Formula | C4H6N4O3 |
| Exact Mass | 158.0439 |
| Average Mass | 158.1156 |
| SMILES | NC(=O)N[C@H](N1)C(=O)NC(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
