BMMCHC--a013
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C00845 |
KNApSAcK | |
CDX file | |
MOL file | BMMCHC--a013.mol |
2-Furoyl-CoA | |
---|---|
Structural Information | |
Systematic Name | 2-Furoyl-CoA |
Common Name |
|
Symbol | |
Formula | C26H38N7O18P3S |
Exact Mass | 861.1206 |
Average Mass | 861.6035 |
SMILES | C([C@H](C(NCCC(NCCSC(c(c4)occ4)=O)=O)=O)O)(C)(C)CO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |